C19H18BrFN2O5 — CID 126235371
2-[5-bromo-2-ethoxy-4-[(E)-[[2-(4-fluorophenyl)acetyl]hydrazinylidene]methyl]phenoxy]acetic acid (PubChem CID 126235371) has the molecular formula C19H18BrFN2O5 and a molecular weight of 453.26 g/mol. Its IUPAC name is 2-[5-bromo-2-ethoxy-4-[(E)-[[2-(4-fluorophenyl)acetyl]hydrazinylidene]methyl]phenoxy]acetic acid.
| Compound Name | 2-[5-bromo-2-ethoxy-4-[(E)-[[2-(4-fluorophenyl)acetyl]hydrazinylidene]methyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 126235371 |
| Molecular Formula | C19H18BrFN2O5 |
| Molecular Weight | 453.26 g/mol |
| Exact Mass | 452.04 |
| IUPAC Name | 2-[5-bromo-2-ethoxy-4-[(E)-[[2-(4-fluorophenyl)acetyl]hydrazinylidene]methyl]phenoxy]acetic acid |
| SMILES | CCOc1cc(/C=N/NC(=O)Cc2ccc(F)cc2)c(Br)cc1OCC(=O)O |
| InChI | InChI=1S/C19H18BrFN2O5/c1-2-27-16-8-13(15(20)9-17(16)28-11-19(25)26)10-22-23-18(24)7-12-3-5-14(21)6-4-12/h3-6,8-10H,2,7,11H2,1H3,(H,23,24)(H,25,26)/b22-10+ |
| InChIKey | KUSLVUMOWHUDLV-LSHDLFTRSA-N |
| XLogP | 3.14 |
| TPSA | 97.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.26 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|