C12H14BrN3O5 — CID 19655705
2-[5-bromo-4-[(Z)-(carbamoylhydrazinylidene)methyl]-2-ethoxyphenoxy]acetic acid (PubChem CID 19655705) has the molecular formula C12H14BrN3O5 and a molecular weight of 360.16 g/mol. Its IUPAC name is 2-[5-bromo-4-[(Z)-(carbamoylhydrazinylidene)methyl]-2-ethoxyphenoxy]acetic acid.
| Compound Name | 2-[5-bromo-4-[(Z)-(carbamoylhydrazinylidene)methyl]-2-ethoxyphenoxy]acetic acid |
|---|---|
| PubChem CID | 19655705 |
| Molecular Formula | C12H14BrN3O5 |
| Molecular Weight | 360.16 g/mol |
| Exact Mass | 359.01 |
| IUPAC Name | 2-[5-bromo-4-[(Z)-(carbamoylhydrazinylidene)methyl]-2-ethoxyphenoxy]acetic acid |
| SMILES | CCOc1cc(/C=N\NC(N)=O)c(Br)cc1OCC(=O)O |
| InChI | InChI=1S/C12H14BrN3O5/c1-2-20-9-3-7(5-15-16-12(14)19)8(13)4-10(9)21-6-11(17)18/h3-5H,2,6H2,1H3,(H,17,18)(H3,14,16,19)/b15-5- |
| InChIKey | FDCWMCLGDCFXKS-WCSRMQSCSA-N |
| XLogP | 1.31 |
| TPSA | 123.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.16 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|