C19H20BrFN2O3 — CID 126249707
N-[(E)-(2-bromo-4,5-diethoxyphenyl)methylideneamino]-2-(4-fluorophenyl)acetamide (PubChem CID 126249707) has the molecular formula C19H20BrFN2O3 and a molecular weight of 423.28 g/mol. Its IUPAC name is N-[(E)-(2-bromo-4,5-diethoxyphenyl)methylideneamino]-2-(4-fluorophenyl)acetamide.
| Compound Name | N-[(E)-(2-bromo-4,5-diethoxyphenyl)methylideneamino]-2-(4-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 126249707 |
| Molecular Formula | C19H20BrFN2O3 |
| Molecular Weight | 423.28 g/mol |
| Exact Mass | 422.06 |
| IUPAC Name | N-[(E)-(2-bromo-4,5-diethoxyphenyl)methylideneamino]-2-(4-fluorophenyl)acetamide |
| SMILES | CCOc1cc(Br)c(/C=N/NC(=O)Cc2ccc(F)cc2)cc1OCC |
| InChI | InChI=1S/C19H20BrFN2O3/c1-3-25-17-10-14(16(20)11-18(17)26-4-2)12-22-23-19(24)9-13-5-7-15(21)8-6-13/h5-8,10-12H,3-4,9H2,1-2H3,(H,23,24)/b22-12+ |
| InChIKey | SCDUZFLXQORNEW-WSDLNYQXSA-N |
| XLogP | 4.08 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.28 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|