C25H18Br2FN3O5 — CID 21376321
5,7-dibromo-N-[(Z)-[4-[2-(4-fluoroanilino)-2-oxoethoxy]-3-methoxyphenyl]methylideneamino]-1-benzofuran-2-carboxamide (PubChem CID 21376321) has the molecular formula C25H18Br2FN3O5 and a molecular weight of 619.24 g/mol. Its IUPAC name is 5,7-dibromo-N-[(Z)-[4-[2-(4-fluoroanilino)-2-oxoethoxy]-3-methoxyphenyl]methylideneamino]-1-benzofuran-2-carboxamide.
| Compound Name | 5,7-dibromo-N-[(Z)-[4-[2-(4-fluoroanilino)-2-oxoethoxy]-3-methoxyphenyl]methylideneamino]-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 21376321 |
| Molecular Formula | C25H18Br2FN3O5 |
| Molecular Weight | 619.24 g/mol |
| Exact Mass | 616.96 |
| IUPAC Name | 5,7-dibromo-N-[(Z)-[4-[2-(4-fluoroanilino)-2-oxoethoxy]-3-methoxyphenyl]methylideneamino]-1-benzofuran-2-carboxamide |
| SMILES | COc1cc(/C=N\NC(=O)c2cc3cc(Br)cc(Br)c3o2)ccc1OCC(=O)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C25H18Br2FN3O5/c1-34-21-8-14(2-7-20(21)35-13-23(32)30-18-5-3-17(28)4-6-18)12-29-31-25(33)22-10-15-9-16(26)11-19(27)24(15)36-22/h2-12H,13H2,1H3,(H,30,32)(H,31,33)/b29-12- |
| InChIKey | DUPLNWTVIKIMRM-ULPWCQAASA-N |
| XLogP | 5.89 |
| TPSA | 102.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.24 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|