C25H17Br2FIN3O5 — CID 21376341
5,7-dibromo-N-[(Z)-[4-[2-(4-fluoroanilino)-2-oxoethoxy]-3-iodo-5-methoxyphenyl]methylideneamino]-1-benzofuran-2-carboxamide (PubChem CID 21376341) has the molecular formula C25H17Br2FIN3O5 and a molecular weight of 745.14 g/mol. Its IUPAC name is 5,7-dibromo-N-[(Z)-[4-[2-(4-fluoroanilino)-2-oxoethoxy]-3-iodo-5-methoxyphenyl]methylideneamino]-1-benzofuran-2-carboxamide.
| Compound Name | 5,7-dibromo-N-[(Z)-[4-[2-(4-fluoroanilino)-2-oxoethoxy]-3-iodo-5-methoxyphenyl]methylideneamino]-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 21376341 |
| Molecular Formula | C25H17Br2FIN3O5 |
| Molecular Weight | 745.14 g/mol |
| Exact Mass | 742.86 |
| IUPAC Name | 5,7-dibromo-N-[(Z)-[4-[2-(4-fluoroanilino)-2-oxoethoxy]-3-iodo-5-methoxyphenyl]methylideneamino]-1-benzofuran-2-carboxamide |
| SMILES | COc1cc(/C=N\NC(=O)c2cc3cc(Br)cc(Br)c3o2)cc(I)c1OCC(=O)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C25H17Br2FIN3O5/c1-35-20-7-13(6-19(29)24(20)36-12-22(33)31-17-4-2-16(28)3-5-17)11-30-32-25(34)21-9-14-8-15(26)10-18(27)23(14)37-21/h2-11H,12H2,1H3,(H,31,33)(H,32,34)/b30-11- |
| InChIKey | ILRRDMWPBGGYSV-OHUIHDMLSA-N |
| XLogP | 6.49 |
| TPSA | 102.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 745.14 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|