C26H19BrClFIN3O5 — CID 126019167
5-bromo-N-[(Z)-[3-chloro-5-ethoxy-4-[2-(4-fluoroanilino)-2-oxoethoxy]phenyl]methylideneamino]-7-iodo-1-benzofuran-2-carboxamide (PubChem CID 126019167) has the molecular formula C26H19BrClFIN3O5 and a molecular weight of 714.71 g/mol. Its IUPAC name is 5-bromo-N-[(Z)-[3-chloro-5-ethoxy-4-[2-(4-fluoroanilino)-2-oxoethoxy]phenyl]methylideneamino]-7-iodo-1-benzofuran-2-carboxamide.
| Compound Name | 5-bromo-N-[(Z)-[3-chloro-5-ethoxy-4-[2-(4-fluoroanilino)-2-oxoethoxy]phenyl]methylideneamino]-7-iodo-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 126019167 |
| Molecular Formula | C26H19BrClFIN3O5 |
| Molecular Weight | 714.71 g/mol |
| Exact Mass | 712.92 |
| IUPAC Name | 5-bromo-N-[(Z)-[3-chloro-5-ethoxy-4-[2-(4-fluoroanilino)-2-oxoethoxy]phenyl]methylideneamino]-7-iodo-1-benzofuran-2-carboxamide |
| SMILES | CCOc1cc(/C=N\NC(=O)c2cc3cc(Br)cc(I)c3o2)cc(Cl)c1OCC(=O)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C26H19BrClFIN3O5/c1-2-36-21-8-14(7-19(28)25(21)37-13-23(34)32-18-5-3-17(29)4-6-18)12-31-33-26(35)22-10-15-9-16(27)11-20(30)24(15)38-22/h3-12H,2,13H2,1H3,(H,32,34)(H,33,35)/b31-12- |
| InChIKey | KLZJFVAWRJLMIP-HCNMGLPWSA-N |
| XLogP | 6.77 |
| TPSA | 102.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 714.71 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|