C24H17Br2FN2O4 — CID 21375567
5,7-dibromo-N-[(Z)-[4-[(4-fluorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]-1-benzofuran-2-carboxamide (PubChem CID 21375567) has the molecular formula C24H17Br2FN2O4 and a molecular weight of 576.22 g/mol. Its IUPAC name is 5,7-dibromo-N-[(Z)-[4-[(4-fluorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]-1-benzofuran-2-carboxamide.
| Compound Name | 5,7-dibromo-N-[(Z)-[4-[(4-fluorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 21375567 |
| Molecular Formula | C24H17Br2FN2O4 |
| Molecular Weight | 576.22 g/mol |
| Exact Mass | 573.95 |
| IUPAC Name | 5,7-dibromo-N-[(Z)-[4-[(4-fluorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]-1-benzofuran-2-carboxamide |
| SMILES | COc1cc(/C=N\NC(=O)c2cc3cc(Br)cc(Br)c3o2)ccc1OCc1ccc(F)cc1 |
| InChI | InChI=1S/C24H17Br2FN2O4/c1-31-21-8-15(4-7-20(21)32-13-14-2-5-18(27)6-3-14)12-28-29-24(30)22-10-16-9-17(25)11-19(26)23(16)33-22/h2-12H,13H2,1H3,(H,29,30)/b28-12- |
| InChIKey | WSCZKHURFCEKLS-NVJOKUIPSA-N |
| XLogP | 6.45 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.22 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|