C17H11Br3N2O3 — CID 21376071
5,7-dibromo-N-[(Z)-(5-bromo-2-methoxyphenyl)methylideneamino]-1-benzofuran-2-carboxamide (PubChem CID 21376071) has the molecular formula C17H11Br3N2O3 and a molecular weight of 531.00 g/mol. Its IUPAC name is 5,7-dibromo-N-[(Z)-(5-bromo-2-methoxyphenyl)methylideneamino]-1-benzofuran-2-carboxamide.
| Compound Name | 5,7-dibromo-N-[(Z)-(5-bromo-2-methoxyphenyl)methylideneamino]-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 21376071 |
| Molecular Formula | C17H11Br3N2O3 |
| Molecular Weight | 531.00 g/mol |
| Exact Mass | 527.83 |
| IUPAC Name | 5,7-dibromo-N-[(Z)-(5-bromo-2-methoxyphenyl)methylideneamino]-1-benzofuran-2-carboxamide |
| SMILES | COc1ccc(Br)cc1/C=N\NC(=O)c1cc2cc(Br)cc(Br)c2o1 |
| InChI | InChI=1S/C17H11Br3N2O3/c1-24-14-3-2-11(18)5-10(14)8-21-22-17(23)15-6-9-4-12(19)7-13(20)16(9)25-15/h2-8H,1H3,(H,22,23)/b21-8- |
| InChIKey | JWQJQNXFWGGYDY-WNFQYIGGSA-N |
| XLogP | 5.49 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.00 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|