C18H10Br3N3O2 — CID 135563380
5,7-dibromo-N-[(Z)-(5-bromo-1H-indol-3-yl)methylideneamino]-1-benzofuran-2-carboxamide (PubChem CID 135563380) has the molecular formula C18H10Br3N3O2 and a molecular weight of 540.01 g/mol. Its IUPAC name is 5,7-dibromo-N-[(Z)-(5-bromo-1H-indol-3-yl)methylideneamino]-1-benzofuran-2-carboxamide.
| Compound Name | 5,7-dibromo-N-[(Z)-(5-bromo-1H-indol-3-yl)methylideneamino]-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 135563380 |
| Molecular Formula | C18H10Br3N3O2 |
| Molecular Weight | 540.01 g/mol |
| Exact Mass | 536.83 |
| IUPAC Name | 5,7-dibromo-N-[(Z)-(5-bromo-1H-indol-3-yl)methylideneamino]-1-benzofuran-2-carboxamide |
| SMILES | O=C(N/N=C\c1c[nH]c2ccc(Br)cc12)c1cc2cc(Br)cc(Br)c2o1 |
| InChI | InChI=1S/C18H10Br3N3O2/c19-11-1-2-15-13(5-11)10(7-22-15)8-23-24-18(25)16-4-9-3-12(20)6-14(21)17(9)26-16/h1-8,22H,(H,24,25)/b23-8- |
| InChIKey | PTQGMHGAZVRBLH-NYAPKIOYSA-N |
| XLogP | 5.97 |
| TPSA | 70.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.01 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|