C15H10Br2N2O2S — CID 21376233
5,7-dibromo-N-[(Z)-(5-methylthiophen-2-yl)methylideneamino]-1-benzofuran-2-carboxamide (PubChem CID 21376233) has the molecular formula C15H10Br2N2O2S and a molecular weight of 442.13 g/mol. Its IUPAC name is 5,7-dibromo-N-[(Z)-(5-methylthiophen-2-yl)methylideneamino]-1-benzofuran-2-carboxamide.
| Compound Name | 5,7-dibromo-N-[(Z)-(5-methylthiophen-2-yl)methylideneamino]-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 21376233 |
| Molecular Formula | C15H10Br2N2O2S |
| Molecular Weight | 442.13 g/mol |
| Exact Mass | 439.88 |
| IUPAC Name | 5,7-dibromo-N-[(Z)-(5-methylthiophen-2-yl)methylideneamino]-1-benzofuran-2-carboxamide |
| SMILES | Cc1ccc(/C=N\NC(=O)c2cc3cc(Br)cc(Br)c3o2)s1 |
| InChI | InChI=1S/C15H10Br2N2O2S/c1-8-2-3-11(22-8)7-18-19-15(20)13-5-9-4-10(16)6-12(17)14(9)21-13/h2-7H,1H3,(H,19,20)/b18-7- |
| InChIKey | YQHBPGAZFZEZJA-WSVATBPTSA-N |
| XLogP | 5.09 |
| TPSA | 54.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.13 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|