C20H13Br2N3O2 — CID 21376279
5,7-dibromo-N-[(Z)-(1-phenylpyrrol-2-yl)methylideneamino]-1-benzofuran-2-carboxamide (PubChem CID 21376279) has the molecular formula C20H13Br2N3O2 and a molecular weight of 487.15 g/mol. Its IUPAC name is 5,7-dibromo-N-[(Z)-(1-phenylpyrrol-2-yl)methylideneamino]-1-benzofuran-2-carboxamide.
| Compound Name | 5,7-dibromo-N-[(Z)-(1-phenylpyrrol-2-yl)methylideneamino]-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 21376279 |
| Molecular Formula | C20H13Br2N3O2 |
| Molecular Weight | 487.15 g/mol |
| Exact Mass | 484.94 |
| IUPAC Name | 5,7-dibromo-N-[(Z)-(1-phenylpyrrol-2-yl)methylideneamino]-1-benzofuran-2-carboxamide |
| SMILES | O=C(N/N=C\c1cccn1-c1ccccc1)c1cc2cc(Br)cc(Br)c2o1 |
| InChI | InChI=1S/C20H13Br2N3O2/c21-14-9-13-10-18(27-19(13)17(22)11-14)20(26)24-23-12-16-7-4-8-25(16)15-5-2-1-3-6-15/h1-12H,(H,24,26)/b23-12- |
| InChIKey | OYDADKCCHSQMDO-FMCGGJTJSA-N |
| XLogP | 5.51 |
| TPSA | 59.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.15 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_pyrrol(64)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|