C20H12Br2N4O2 — CID 21376065
5,7-dibromo-N-[(Z)-[1-(cyanomethyl)indol-3-yl]methylideneamino]-1-benzofuran-2-carboxamide (PubChem CID 21376065) has the molecular formula C20H12Br2N4O2 and a molecular weight of 500.15 g/mol. Its IUPAC name is 5,7-dibromo-N-[(Z)-[1-(cyanomethyl)indol-3-yl]methylideneamino]-1-benzofuran-2-carboxamide.
| Compound Name | 5,7-dibromo-N-[(Z)-[1-(cyanomethyl)indol-3-yl]methylideneamino]-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 21376065 |
| Molecular Formula | C20H12Br2N4O2 |
| Molecular Weight | 500.15 g/mol |
| Exact Mass | 497.93 |
| IUPAC Name | 5,7-dibromo-N-[(Z)-[1-(cyanomethyl)indol-3-yl]methylideneamino]-1-benzofuran-2-carboxamide |
| SMILES | N#CCn1cc(/C=N\NC(=O)c2cc3cc(Br)cc(Br)c3o2)c2ccccc21 |
| InChI | InChI=1S/C20H12Br2N4O2/c21-14-7-12-8-18(28-19(12)16(22)9-14)20(27)25-24-10-13-11-26(6-5-23)17-4-2-1-3-15(13)17/h1-4,7-11H,6H2,(H,25,27)/b24-10- |
| InChIKey | ALYKPQHPFGKLML-VROXFSQNSA-N |
| XLogP | 5.20 |
| TPSA | 83.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.15 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|