C27H20BrN3O2 — CID 3252604
N-[(1-benzylindol-3-yl)methylideneamino]-5-(4-bromophenyl)furan-2-carboxamide (PubChem CID 3252604) has the molecular formula C27H20BrN3O2 and a molecular weight of 498.38 g/mol. Its IUPAC name is N-[(1-benzylindol-3-yl)methylideneamino]-5-(4-bromophenyl)furan-2-carboxamide.
| Compound Name | N-[(1-benzylindol-3-yl)methylideneamino]-5-(4-bromophenyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 3252604 |
| Molecular Formula | C27H20BrN3O2 |
| Molecular Weight | 498.38 g/mol |
| Exact Mass | 497.07 |
| IUPAC Name | N-[(1-benzylindol-3-yl)methylideneamino]-5-(4-bromophenyl)furan-2-carboxamide |
| SMILES | O=C(NN=Cc1cn(Cc2ccccc2)c2ccccc12)c1ccc(-c2ccc(Br)cc2)o1 |
| InChI | InChI=1S/C27H20BrN3O2/c28-22-12-10-20(11-13-22)25-14-15-26(33-25)27(32)30-29-16-21-18-31(17-19-6-2-1-3-7-19)24-9-5-4-8-23(21)24/h1-16,18H,17H2,(H,30,32) |
| InChIKey | TWYVOYDAOKRDRG-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 59.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.38 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|