C24H19Br2N3O — CID 98050723
2-(4-bromophenyl)-N-[(Z)-[1-[(4-bromophenyl)methyl]indol-3-yl]methylideneamino]acetamide (PubChem CID 98050723) has the molecular formula C24H19Br2N3O and a molecular weight of 525.24 g/mol. Its IUPAC name is 2-(4-bromophenyl)-N-[(Z)-[1-[(4-bromophenyl)methyl]indol-3-yl]methylideneamino]acetamide.
| Compound Name | 2-(4-bromophenyl)-N-[(Z)-[1-[(4-bromophenyl)methyl]indol-3-yl]methylideneamino]acetamide |
|---|---|
| PubChem CID | 98050723 |
| Molecular Formula | C24H19Br2N3O |
| Molecular Weight | 525.24 g/mol |
| Exact Mass | 522.99 |
| IUPAC Name | 2-(4-bromophenyl)-N-[(Z)-[1-[(4-bromophenyl)methyl]indol-3-yl]methylideneamino]acetamide |
| SMILES | O=C(Cc1ccc(Br)cc1)N/N=C\c1cn(Cc2ccc(Br)cc2)c2ccccc12 |
| InChI | InChI=1S/C24H19Br2N3O/c25-20-9-5-17(6-10-20)13-24(30)28-27-14-19-16-29(23-4-2-1-3-22(19)23)15-18-7-11-21(26)12-8-18/h1-12,14,16H,13,15H2,(H,28,30)/b27-14- |
| InChIKey | FGEHISKAXLDAMJ-VYYCAZPPSA-N |
| XLogP | 5.91 |
| TPSA | 46.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.24 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|