C26H24IN3O — CID 5033180
2-(3,4-dimethylphenyl)-N-[[1-[(4-iodophenyl)methyl]indol-3-yl]methylideneamino]acetamide (PubChem CID 5033180) has the molecular formula C26H24IN3O and a molecular weight of 521.40 g/mol. Its IUPAC name is 2-(3,4-dimethylphenyl)-N-[[1-[(4-iodophenyl)methyl]indol-3-yl]methylideneamino]acetamide.
| Compound Name | 2-(3,4-dimethylphenyl)-N-[[1-[(4-iodophenyl)methyl]indol-3-yl]methylideneamino]acetamide |
|---|---|
| PubChem CID | 5033180 |
| Molecular Formula | C26H24IN3O |
| Molecular Weight | 521.40 g/mol |
| Exact Mass | 521.10 |
| IUPAC Name | 2-(3,4-dimethylphenyl)-N-[[1-[(4-iodophenyl)methyl]indol-3-yl]methylideneamino]acetamide |
| SMILES | Cc1ccc(CC(=O)NN=Cc2cn(Cc3ccc(I)cc3)c3ccccc23)cc1C |
| InChI | InChI=1S/C26H24IN3O/c1-18-7-8-21(13-19(18)2)14-26(31)29-28-15-22-17-30(25-6-4-3-5-24(22)25)16-20-9-11-23(27)12-10-20/h3-13,15,17H,14,16H2,1-2H3,(H,29,31) |
| InChIKey | FHNDSWKRQODODS-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 46.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.40 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|