C17H15IN4O — CID 6045592
[(Z)-[1-[(4-iodophenyl)methyl]indol-3-yl]methylideneamino]urea (PubChem CID 6045592) has the molecular formula C17H15IN4O and a molecular weight of 418.24 g/mol. Its IUPAC name is [(Z)-[1-[(4-iodophenyl)methyl]indol-3-yl]methylideneamino]urea.
| Compound Name | [(Z)-[1-[(4-iodophenyl)methyl]indol-3-yl]methylideneamino]urea |
|---|---|
| PubChem CID | 6045592 |
| Molecular Formula | C17H15IN4O |
| Molecular Weight | 418.24 g/mol |
| Exact Mass | 418.03 |
| IUPAC Name | [(Z)-[1-[(4-iodophenyl)methyl]indol-3-yl]methylideneamino]urea |
| SMILES | NC(=O)N/N=C\c1cn(Cc2ccc(I)cc2)c2ccccc12 |
| InChI | InChI=1S/C17H15IN4O/c18-14-7-5-12(6-8-14)10-22-11-13(9-20-21-17(19)23)15-3-1-2-4-16(15)22/h1-9,11H,10H2,(H3,19,21,23)/b20-9- |
| InChIKey | JXIJJDNMRQLOQI-UKWGHVSLSA-N |
| XLogP | 3.30 |
| TPSA | 72.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.24 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|