C18H15N5O — CID 3906318
[[1-[(2-cyanophenyl)methyl]indol-3-yl]methylideneamino]urea (PubChem CID 3906318) has the molecular formula C18H15N5O and a molecular weight of 317.35 g/mol. Its IUPAC name is [[1-[(2-cyanophenyl)methyl]indol-3-yl]methylideneamino]urea.
| Compound Name | [[1-[(2-cyanophenyl)methyl]indol-3-yl]methylideneamino]urea |
|---|---|
| PubChem CID | 3906318 |
| Molecular Formula | C18H15N5O |
| Molecular Weight | 317.35 g/mol |
| Exact Mass | 317.13 |
| IUPAC Name | [[1-[(2-cyanophenyl)methyl]indol-3-yl]methylideneamino]urea |
| SMILES | N#Cc1ccccc1Cn1cc(C=NNC(N)=O)c2ccccc21 |
| InChI | InChI=1S/C18H15N5O/c19-9-13-5-1-2-6-14(13)11-23-12-15(10-21-22-18(20)24)16-7-3-4-8-17(16)23/h1-8,10,12H,11H2,(H3,20,22,24) |
| InChIKey | GLNQNKUTHGFRNE-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 96.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.35 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|