C25H21N5OS — CID 156580101
1-[(E)-[1-[(2-cyanophenyl)methyl]indol-3-yl]methylideneamino]-3-(4-methoxyphenyl)thiourea (PubChem CID 156580101) has the molecular formula C25H21N5OS and a molecular weight of 439.54 g/mol. Its IUPAC name is 1-[(E)-[1-[(2-cyanophenyl)methyl]indol-3-yl]methylideneamino]-3-(4-methoxyphenyl)thiourea.
| Compound Name | 1-[(E)-[1-[(2-cyanophenyl)methyl]indol-3-yl]methylideneamino]-3-(4-methoxyphenyl)thiourea |
|---|---|
| PubChem CID | 156580101 |
| Molecular Formula | C25H21N5OS |
| Molecular Weight | 439.54 g/mol |
| Exact Mass | 439.15 |
| IUPAC Name | 1-[(E)-[1-[(2-cyanophenyl)methyl]indol-3-yl]methylideneamino]-3-(4-methoxyphenyl)thiourea |
| SMILES | COc1ccc(NC(=S)N/N=C/c2cn(Cc3ccccc3C#N)c3ccccc23)cc1 |
| InChI | InChI=1S/C25H21N5OS/c1-31-22-12-10-21(11-13-22)28-25(32)29-27-15-20-17-30(24-9-5-4-8-23(20)24)16-19-7-3-2-6-18(19)14-26/h2-13,15,17H,16H2,1H3,(H2,28,29,32)/b27-15+ |
| InChIKey | YCRKQEJWKOJYMG-JFLMPSFJSA-N |
| XLogP | 4.89 |
| TPSA | 74.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.54 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thio_urea_I(3)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|