C26H20FN3O2 — CID 22300098
(Z)-2-cyano-3-[1-[(2-fluorophenyl)methyl]indol-3-yl]-N-(4-methoxyphenyl)prop-2-enamide (PubChem CID 22300098) has the molecular formula C26H20FN3O2 and a molecular weight of 425.46 g/mol. Its IUPAC name is (Z)-2-cyano-3-[1-[(2-fluorophenyl)methyl]indol-3-yl]-N-(4-methoxyphenyl)prop-2-enamide.
| Compound Name | (Z)-2-cyano-3-[1-[(2-fluorophenyl)methyl]indol-3-yl]-N-(4-methoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 22300098 |
| Molecular Formula | C26H20FN3O2 |
| Molecular Weight | 425.46 g/mol |
| Exact Mass | 425.15 |
| IUPAC Name | (Z)-2-cyano-3-[1-[(2-fluorophenyl)methyl]indol-3-yl]-N-(4-methoxyphenyl)prop-2-enamide |
| SMILES | COc1ccc(NC(=O)/C(C#N)=C\c2cn(Cc3ccccc3F)c3ccccc23)cc1 |
| InChI | InChI=1S/C26H20FN3O2/c1-32-22-12-10-21(11-13-22)29-26(31)19(15-28)14-20-17-30(25-9-5-3-7-23(20)25)16-18-6-2-4-8-24(18)27/h2-14,17H,16H2,1H3,(H,29,31)/b19-14- |
| InChIKey | ZNZVNLPUEOUBRH-RGEXLXHISA-N |
| XLogP | 5.38 |
| TPSA | 67.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.46 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|