C27H22FN3O2 — CID 124646993
(Z)-2-cyano-3-[1-[(2-fluorophenyl)methyl]indol-3-yl]-N-[(4-methoxyphenyl)methyl]prop-2-enamide (PubChem CID 124646993) has the molecular formula C27H22FN3O2 and a molecular weight of 439.49 g/mol. Its IUPAC name is (Z)-2-cyano-3-[1-[(2-fluorophenyl)methyl]indol-3-yl]-N-[(4-methoxyphenyl)methyl]prop-2-enamide.
| Compound Name | (Z)-2-cyano-3-[1-[(2-fluorophenyl)methyl]indol-3-yl]-N-[(4-methoxyphenyl)methyl]prop-2-enamide |
|---|---|
| PubChem CID | 124646993 |
| Molecular Formula | C27H22FN3O2 |
| Molecular Weight | 439.49 g/mol |
| Exact Mass | 439.17 |
| IUPAC Name | (Z)-2-cyano-3-[1-[(2-fluorophenyl)methyl]indol-3-yl]-N-[(4-methoxyphenyl)methyl]prop-2-enamide |
| SMILES | COc1ccc(CNC(=O)/C(C#N)=C\c2cn(Cc3ccccc3F)c3ccccc23)cc1 |
| InChI | InChI=1S/C27H22FN3O2/c1-33-23-12-10-19(11-13-23)16-30-27(32)21(15-29)14-22-18-31(26-9-5-3-7-24(22)26)17-20-6-2-4-8-25(20)28/h2-14,18H,16-17H2,1H3,(H,30,32)/b21-14- |
| InChIKey | GACGOBSBUCGLFN-STZFKDTASA-N |
| XLogP | 5.06 |
| TPSA | 67.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.49 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|