C28H24FN3O2 — CID 18531080
(Z)-2-cyano-3-[1-[(2-fluorophenyl)methyl]-2-methylindol-3-yl]-N-[(4-methoxyphenyl)methyl]prop-2-enamide (PubChem CID 18531080) has the molecular formula C28H24FN3O2 and a molecular weight of 453.52 g/mol. Its IUPAC name is (Z)-2-cyano-3-[1-[(2-fluorophenyl)methyl]-2-methylindol-3-yl]-N-[(4-methoxyphenyl)methyl]prop-2-enamide.
| Compound Name | (Z)-2-cyano-3-[1-[(2-fluorophenyl)methyl]-2-methylindol-3-yl]-N-[(4-methoxyphenyl)methyl]prop-2-enamide |
|---|---|
| PubChem CID | 18531080 |
| Molecular Formula | C28H24FN3O2 |
| Molecular Weight | 453.52 g/mol |
| Exact Mass | 453.19 |
| IUPAC Name | (Z)-2-cyano-3-[1-[(2-fluorophenyl)methyl]-2-methylindol-3-yl]-N-[(4-methoxyphenyl)methyl]prop-2-enamide |
| SMILES | COc1ccc(CNC(=O)/C(C#N)=C\c2c(C)n(Cc3ccccc3F)c3ccccc23)cc1 |
| InChI | InChI=1S/C28H24FN3O2/c1-19-25(15-22(16-30)28(33)31-17-20-11-13-23(34-2)14-12-20)24-8-4-6-10-27(24)32(19)18-21-7-3-5-9-26(21)29/h3-15H,17-18H2,1-2H3,(H,31,33)/b22-15- |
| InChIKey | ORZMRFFXUARAJG-JCMHNJIXSA-N |
| XLogP | 5.37 |
| TPSA | 67.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.52 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|