C30H22ClN3O — CID 7084373
(Z)-3-[1-[(4-chlorophenyl)methyl]-2-methylindol-3-yl]-2-cyano-N-naphthalen-2-ylprop-2-enamide (PubChem CID 7084373) has the molecular formula C30H22ClN3O and a molecular weight of 475.98 g/mol. Its IUPAC name is (Z)-3-[1-[(4-chlorophenyl)methyl]-2-methylindol-3-yl]-2-cyano-N-naphthalen-2-ylprop-2-enamide.
| Compound Name | (Z)-3-[1-[(4-chlorophenyl)methyl]-2-methylindol-3-yl]-2-cyano-N-naphthalen-2-ylprop-2-enamide |
|---|---|
| PubChem CID | 7084373 |
| Molecular Formula | C30H22ClN3O |
| Molecular Weight | 475.98 g/mol |
| Exact Mass | 475.15 |
| IUPAC Name | (Z)-3-[1-[(4-chlorophenyl)methyl]-2-methylindol-3-yl]-2-cyano-N-naphthalen-2-ylprop-2-enamide |
| SMILES | Cc1c(/C=C(/C#N)C(=O)Nc2ccc3ccccc3c2)c2ccccc2n1Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C30H22ClN3O/c1-20-28(27-8-4-5-9-29(27)34(20)19-21-10-13-25(31)14-11-21)17-24(18-32)30(35)33-26-15-12-22-6-2-3-7-23(22)16-26/h2-17H,19H2,1H3,(H,33,35)/b24-17- |
| InChIKey | MAZWBKFHTYZEAQ-ULJHMMPZSA-N |
| XLogP | 7.35 |
| TPSA | 57.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.98 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|