C26H25Cl2N3O — CID 35261623
(E)-2-cyano-N-cyclohexyl-3-[1-[(2,4-dichlorophenyl)methyl]-2-methylindol-3-yl]prop-2-enamide (PubChem CID 35261623) has the molecular formula C26H25Cl2N3O and a molecular weight of 466.41 g/mol. Its IUPAC name is (E)-2-cyano-N-cyclohexyl-3-[1-[(2,4-dichlorophenyl)methyl]-2-methylindol-3-yl]prop-2-enamide.
| Compound Name | (E)-2-cyano-N-cyclohexyl-3-[1-[(2,4-dichlorophenyl)methyl]-2-methylindol-3-yl]prop-2-enamide |
|---|---|
| PubChem CID | 35261623 |
| Molecular Formula | C26H25Cl2N3O |
| Molecular Weight | 466.41 g/mol |
| Exact Mass | 465.14 |
| IUPAC Name | (E)-2-cyano-N-cyclohexyl-3-[1-[(2,4-dichlorophenyl)methyl]-2-methylindol-3-yl]prop-2-enamide |
| SMILES | Cc1c(/C=C(\C#N)C(=O)NC2CCCCC2)c2ccccc2n1Cc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C26H25Cl2N3O/c1-17-23(13-19(15-29)26(32)30-21-7-3-2-4-8-21)22-9-5-6-10-25(22)31(17)16-18-11-12-20(27)14-24(18)28/h5-6,9-14,21H,2-4,7-8,16H2,1H3,(H,30,32)/b19-13+ |
| InChIKey | VCYONDNAMDJUJE-CPNJWEJPSA-N |
| XLogP | 6.66 |
| TPSA | 57.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.41 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|