C25H18Cl2N2 — CID 126362348
(Z)-2-(4-chlorophenyl)-3-[1-[(2-chlorophenyl)methyl]-2-methylindol-3-yl]prop-2-enenitrile (PubChem CID 126362348) has the molecular formula C25H18Cl2N2 and a molecular weight of 417.34 g/mol. Its IUPAC name is (Z)-2-(4-chlorophenyl)-3-[1-[(2-chlorophenyl)methyl]-2-methylindol-3-yl]prop-2-enenitrile.
| Compound Name | (Z)-2-(4-chlorophenyl)-3-[1-[(2-chlorophenyl)methyl]-2-methylindol-3-yl]prop-2-enenitrile |
|---|---|
| PubChem CID | 126362348 |
| Molecular Formula | C25H18Cl2N2 |
| Molecular Weight | 417.34 g/mol |
| Exact Mass | 416.08 |
| IUPAC Name | (Z)-2-(4-chlorophenyl)-3-[1-[(2-chlorophenyl)methyl]-2-methylindol-3-yl]prop-2-enenitrile |
| SMILES | Cc1c(/C=C(\C#N)c2ccc(Cl)cc2)c2ccccc2n1Cc1ccccc1Cl |
| InChI | InChI=1S/C25H18Cl2N2/c1-17-23(14-20(15-28)18-10-12-21(26)13-11-18)22-7-3-5-9-25(22)29(17)16-19-6-2-4-8-24(19)27/h2-14H,16H2,1H3/b20-14+ |
| InChIKey | ISTVEKKWSWNBHU-XSFVSMFZSA-N |
| XLogP | 7.37 |
| TPSA | 28.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.34 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|