C25H19ClN2 — CID 126005354
(E)-2-(4-chlorophenyl)-3-[1-[(3-methylphenyl)methyl]indol-3-yl]prop-2-enenitrile (PubChem CID 126005354) has the molecular formula C25H19ClN2 and a molecular weight of 382.89 g/mol. Its IUPAC name is (E)-2-(4-chlorophenyl)-3-[1-[(3-methylphenyl)methyl]indol-3-yl]prop-2-enenitrile.
| Compound Name | (E)-2-(4-chlorophenyl)-3-[1-[(3-methylphenyl)methyl]indol-3-yl]prop-2-enenitrile |
|---|---|
| PubChem CID | 126005354 |
| Molecular Formula | C25H19ClN2 |
| Molecular Weight | 382.89 g/mol |
| Exact Mass | 382.12 |
| IUPAC Name | (E)-2-(4-chlorophenyl)-3-[1-[(3-methylphenyl)methyl]indol-3-yl]prop-2-enenitrile |
| SMILES | Cc1cccc(Cn2cc(/C=C(/C#N)c3ccc(Cl)cc3)c3ccccc32)c1 |
| InChI | InChI=1S/C25H19ClN2/c1-18-5-4-6-19(13-18)16-28-17-22(24-7-2-3-8-25(24)28)14-21(15-27)20-9-11-23(26)12-10-20/h2-14,17H,16H2,1H3/b21-14- |
| InChIKey | QFHVEVGHDYPQAM-STZFKDTASA-N |
| XLogP | 6.72 |
| TPSA | 28.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.89 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|