C24H15Cl2N3O2 — CID 3304288
3-[1-[(2,4-dichlorophenyl)methyl]indol-3-yl]-2-(4-nitrophenyl)prop-2-enenitrile (PubChem CID 3304288) has the molecular formula C24H15Cl2N3O2 and a molecular weight of 448.31 g/mol. Its IUPAC name is 3-[1-[(2,4-dichlorophenyl)methyl]indol-3-yl]-2-(4-nitrophenyl)prop-2-enenitrile.
| Compound Name | 3-[1-[(2,4-dichlorophenyl)methyl]indol-3-yl]-2-(4-nitrophenyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 3304288 |
| Molecular Formula | C24H15Cl2N3O2 |
| Molecular Weight | 448.31 g/mol |
| Exact Mass | 447.05 |
| IUPAC Name | 3-[1-[(2,4-dichlorophenyl)methyl]indol-3-yl]-2-(4-nitrophenyl)prop-2-enenitrile |
| SMILES | N#CC(=Cc1cn(Cc2ccc(Cl)cc2Cl)c2ccccc12)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C24H15Cl2N3O2/c25-20-8-5-17(23(26)12-20)14-28-15-19(22-3-1-2-4-24(22)28)11-18(13-27)16-6-9-21(10-7-16)29(30)31/h1-12,15H,14H2 |
| InChIKey | JPJCMMSIOMSMOP-UHFFFAOYSA-N |
| XLogP | 6.97 |
| TPSA | 71.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.31 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|