C32H22Cl2N4 — CID 126339698
(E)-2-(1-benzylbenzimidazol-2-yl)-3-[1-[(2,4-dichlorophenyl)methyl]indol-3-yl]prop-2-enenitrile (PubChem CID 126339698) has the molecular formula C32H22Cl2N4 and a molecular weight of 533.46 g/mol. Its IUPAC name is (E)-2-(1-benzylbenzimidazol-2-yl)-3-[1-[(2,4-dichlorophenyl)methyl]indol-3-yl]prop-2-enenitrile.
| Compound Name | (E)-2-(1-benzylbenzimidazol-2-yl)-3-[1-[(2,4-dichlorophenyl)methyl]indol-3-yl]prop-2-enenitrile |
|---|---|
| PubChem CID | 126339698 |
| Molecular Formula | C32H22Cl2N4 |
| Molecular Weight | 533.46 g/mol |
| Exact Mass | 532.12 |
| IUPAC Name | (E)-2-(1-benzylbenzimidazol-2-yl)-3-[1-[(2,4-dichlorophenyl)methyl]indol-3-yl]prop-2-enenitrile |
| SMILES | N#C/C(=C\c1cn(Cc2ccc(Cl)cc2Cl)c2ccccc12)c1nc2ccccc2n1Cc1ccccc1 |
| InChI | InChI=1S/C32H22Cl2N4/c33-26-15-14-23(28(34)17-26)20-37-21-25(27-10-4-6-12-30(27)37)16-24(18-35)32-36-29-11-5-7-13-31(29)38(32)19-22-8-2-1-3-9-22/h1-17,21H,19-20H2/b24-16+ |
| InChIKey | KIYGXHRIYGWNPP-LFVJCYFKSA-N |
| XLogP | 8.46 |
| TPSA | 46.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.46 |
| LogP ≤ 5 | 8.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|