C25H15Cl2N3S2 — CID 3647356
2-(1,3-benzothiazol-2-ylsulfanyl)-3-[1-[(2,4-dichlorophenyl)methyl]indol-3-yl]prop-2-enenitrile (PubChem CID 3647356) has the molecular formula C25H15Cl2N3S2 and a molecular weight of 492.46 g/mol. Its IUPAC name is 2-(1,3-benzothiazol-2-ylsulfanyl)-3-[1-[(2,4-dichlorophenyl)methyl]indol-3-yl]prop-2-enenitrile.
| Compound Name | 2-(1,3-benzothiazol-2-ylsulfanyl)-3-[1-[(2,4-dichlorophenyl)methyl]indol-3-yl]prop-2-enenitrile |
|---|---|
| PubChem CID | 3647356 |
| Molecular Formula | C25H15Cl2N3S2 |
| Molecular Weight | 492.46 g/mol |
| Exact Mass | 491.01 |
| IUPAC Name | 2-(1,3-benzothiazol-2-ylsulfanyl)-3-[1-[(2,4-dichlorophenyl)methyl]indol-3-yl]prop-2-enenitrile |
| SMILES | N#CC(=Cc1cn(Cc2ccc(Cl)cc2Cl)c2ccccc12)Sc1nc2ccccc2s1 |
| InChI | InChI=1S/C25H15Cl2N3S2/c26-18-10-9-16(21(27)12-18)14-30-15-17(20-5-1-3-7-23(20)30)11-19(13-28)31-25-29-22-6-2-4-8-24(22)32-25/h1-12,15H,14H2 |
| InChIKey | GKFBHFLEPVSGLL-UHFFFAOYSA-N |
| XLogP | 8.26 |
| TPSA | 41.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.46 |
| LogP ≤ 5 | 8.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|