C19H13Cl2N3S — CID 2982472
2-cyano-3-[1-[(2,4-dichlorophenyl)methyl]indol-3-yl]prop-2-enethioamide (PubChem CID 2982472) has the molecular formula C19H13Cl2N3S and a molecular weight of 386.31 g/mol. Its IUPAC name is 2-cyano-3-[1-[(2,4-dichlorophenyl)methyl]indol-3-yl]prop-2-enethioamide.
| Compound Name | 2-cyano-3-[1-[(2,4-dichlorophenyl)methyl]indol-3-yl]prop-2-enethioamide |
|---|---|
| PubChem CID | 2982472 |
| Molecular Formula | C19H13Cl2N3S |
| Molecular Weight | 386.31 g/mol |
| Exact Mass | 385.02 |
| IUPAC Name | 2-cyano-3-[1-[(2,4-dichlorophenyl)methyl]indol-3-yl]prop-2-enethioamide |
| SMILES | N#CC(=Cc1cn(Cc2ccc(Cl)cc2Cl)c2ccccc12)C(N)=S |
| InChI | InChI=1S/C19H13Cl2N3S/c20-15-6-5-12(17(21)8-15)10-24-11-14(7-13(9-22)19(23)25)16-3-1-2-4-18(16)24/h1-8,11H,10H2,(H2,23,25) |
| InChIKey | HEWAJNWAKMBHEO-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 54.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.31 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|