C10H6Cl2N2S — CID 2737937
2-cyano-3-(2,4-dichlorophenyl)prop-2-enethioamide (PubChem CID 2737937) has the molecular formula C10H6Cl2N2S and a molecular weight of 257.15 g/mol. Its IUPAC name is 2-cyano-3-(2,4-dichlorophenyl)prop-2-enethioamide.
| Compound Name | 2-cyano-3-(2,4-dichlorophenyl)prop-2-enethioamide |
|---|---|
| PubChem CID | 2737937 |
| Molecular Formula | C10H6Cl2N2S |
| Molecular Weight | 257.15 g/mol |
| Exact Mass | 255.96 |
| IUPAC Name | 2-cyano-3-(2,4-dichlorophenyl)prop-2-enethioamide |
| SMILES | N#CC(=Cc1ccc(Cl)cc1Cl)C(N)=S |
| InChI | InChI=1S/C10H6Cl2N2S/c11-8-2-1-6(9(12)4-8)3-7(5-13)10(14)15/h1-4H,(H2,14,15) |
| InChIKey | VZFULLMAHIALTN-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 49.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.15 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|