C13H11Cl2NO — CID 47241595
2-[(2,4-dichlorophenyl)methylidene]-4-methyl-3-oxopentanenitrile (PubChem CID 47241595) has the molecular formula C13H11Cl2NO and a molecular weight of 268.14 g/mol. Its IUPAC name is 2-[(2,4-dichlorophenyl)methylidene]-4-methyl-3-oxopentanenitrile.
| Compound Name | 2-[(2,4-dichlorophenyl)methylidene]-4-methyl-3-oxopentanenitrile |
|---|---|
| PubChem CID | 47241595 |
| Molecular Formula | C13H11Cl2NO |
| Molecular Weight | 268.14 g/mol |
| Exact Mass | 267.02 |
| IUPAC Name | 2-[(2,4-dichlorophenyl)methylidene]-4-methyl-3-oxopentanenitrile |
| SMILES | CC(C)C(=O)C(C#N)=Cc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C13H11Cl2NO/c1-8(2)13(17)10(7-16)5-9-3-4-11(14)6-12(9)15/h3-6,8H,1-2H3 |
| InChIKey | QPDHBNNUCHHRAB-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 40.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.14 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|