C13H11Br2NO2 — CID 78889258
(2E)-2-[(3,5-dibromo-4-hydroxyphenyl)methylidene]-4-methyl-3-oxopentanenitrile (PubChem CID 78889258) has the molecular formula C13H11Br2NO2 and a molecular weight of 373.04 g/mol. Its IUPAC name is (2E)-2-[(3,5-dibromo-4-hydroxyphenyl)methylidene]-4-methyl-3-oxopentanenitrile.
| Compound Name | (2E)-2-[(3,5-dibromo-4-hydroxyphenyl)methylidene]-4-methyl-3-oxopentanenitrile |
|---|---|
| PubChem CID | 78889258 |
| Molecular Formula | C13H11Br2NO2 |
| Molecular Weight | 373.04 g/mol |
| Exact Mass | 370.92 |
| IUPAC Name | (2E)-2-[(3,5-dibromo-4-hydroxyphenyl)methylidene]-4-methyl-3-oxopentanenitrile |
| SMILES | CC(C)C(=O)/C(C#N)=C/c1cc(Br)c(O)c(Br)c1 |
| InChI | InChI=1S/C13H11Br2NO2/c1-7(2)12(17)9(6-16)3-8-4-10(14)13(18)11(15)5-8/h3-5,7,18H,1-2H3/b9-3+ |
| InChIKey | JOALYEJOZSAEDY-YCRREMRBSA-N |
| XLogP | 4.05 |
| TPSA | 61.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.04 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|