C13H6Br2N4O — CID 78787167
(3E)-2-amino-4-(3,5-dibromo-4-hydroxyphenyl)buta-1,3-diene-1,1,3-tricarbonitrile (PubChem CID 78787167) has the molecular formula C13H6Br2N4O and a molecular weight of 394.03 g/mol. Its IUPAC name is (3E)-2-amino-4-(3,5-dibromo-4-hydroxyphenyl)buta-1,3-diene-1,1,3-tricarbonitrile.
| Compound Name | (3E)-2-amino-4-(3,5-dibromo-4-hydroxyphenyl)buta-1,3-diene-1,1,3-tricarbonitrile |
|---|---|
| PubChem CID | 78787167 |
| Molecular Formula | C13H6Br2N4O |
| Molecular Weight | 394.03 g/mol |
| Exact Mass | 391.89 |
| IUPAC Name | (3E)-2-amino-4-(3,5-dibromo-4-hydroxyphenyl)buta-1,3-diene-1,1,3-tricarbonitrile |
| SMILES | N#CC(C#N)=C(N)/C(C#N)=C\c1cc(Br)c(O)c(Br)c1 |
| InChI | InChI=1S/C13H6Br2N4O/c14-10-2-7(3-11(15)13(10)20)1-8(4-16)12(19)9(5-17)6-18/h1-3,20H,19H2/b8-1- |
| InChIKey | KASNXTMGTICQGK-QPIMQUGISA-N |
| XLogP | 3.08 |
| TPSA | 117.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.03 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|