C16H8Cl3N3O3 — CID 20834811
(Z)-N-(4-chloro-2-nitrophenyl)-2-cyano-3-(2,4-dichlorophenyl)prop-2-enamide (PubChem CID 20834811) has the molecular formula C16H8Cl3N3O3 and a molecular weight of 396.62 g/mol. Its IUPAC name is (Z)-N-(4-chloro-2-nitrophenyl)-2-cyano-3-(2,4-dichlorophenyl)prop-2-enamide.
| Compound Name | (Z)-N-(4-chloro-2-nitrophenyl)-2-cyano-3-(2,4-dichlorophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 20834811 |
| Molecular Formula | C16H8Cl3N3O3 |
| Molecular Weight | 396.62 g/mol |
| Exact Mass | 394.96 |
| IUPAC Name | (Z)-N-(4-chloro-2-nitrophenyl)-2-cyano-3-(2,4-dichlorophenyl)prop-2-enamide |
| SMILES | N#C/C(=C/c1ccc(Cl)cc1Cl)C(=O)Nc1ccc(Cl)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H8Cl3N3O3/c17-11-2-1-9(13(19)6-11)5-10(8-20)16(23)21-14-4-3-12(18)7-15(14)22(24)25/h1-7H,(H,21,23)/b10-5- |
| InChIKey | XYCKLVNCTJSTHF-YHYXMXQVSA-N |
| XLogP | 5.10 |
| TPSA | 96.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.62 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|