C18H12ClN3O5 — CID 3134652
[4-[3-(4-chloro-2-nitroanilino)-2-cyano-3-oxoprop-1-enyl]phenyl] acetate (PubChem CID 3134652) has the molecular formula C18H12ClN3O5 and a molecular weight of 385.76 g/mol. Its IUPAC name is [4-[3-(4-chloro-2-nitroanilino)-2-cyano-3-oxoprop-1-enyl]phenyl] acetate.
| Compound Name | [4-[3-(4-chloro-2-nitroanilino)-2-cyano-3-oxoprop-1-enyl]phenyl] acetate |
|---|---|
| PubChem CID | 3134652 |
| Molecular Formula | C18H12ClN3O5 |
| Molecular Weight | 385.76 g/mol |
| Exact Mass | 385.05 |
| IUPAC Name | [4-[3-(4-chloro-2-nitroanilino)-2-cyano-3-oxoprop-1-enyl]phenyl] acetate |
| SMILES | CC(=O)Oc1ccc(C=C(C#N)C(=O)Nc2ccc(Cl)cc2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C18H12ClN3O5/c1-11(23)27-15-5-2-12(3-6-15)8-13(10-20)18(24)21-16-7-4-14(19)9-17(16)22(25)26/h2-9H,1H3,(H,21,24) |
| InChIKey | JKIQLFIBMOUPKC-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 122.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.76 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|