C18H12Br2ClN3O4 — CID 4517295
N-(4-chloro-2-nitrophenyl)-2-cyano-3-(3,5-dibromo-4-ethoxyphenyl)prop-2-enamide (PubChem CID 4517295) has the molecular formula C18H12Br2ClN3O4 and a molecular weight of 529.57 g/mol. Its IUPAC name is N-(4-chloro-2-nitrophenyl)-2-cyano-3-(3,5-dibromo-4-ethoxyphenyl)prop-2-enamide.
| Compound Name | N-(4-chloro-2-nitrophenyl)-2-cyano-3-(3,5-dibromo-4-ethoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 4517295 |
| Molecular Formula | C18H12Br2ClN3O4 |
| Molecular Weight | 529.57 g/mol |
| Exact Mass | 526.89 |
| IUPAC Name | N-(4-chloro-2-nitrophenyl)-2-cyano-3-(3,5-dibromo-4-ethoxyphenyl)prop-2-enamide |
| SMILES | CCOc1c(Br)cc(C=C(C#N)C(=O)Nc2ccc(Cl)cc2[N+](=O)[O-])cc1Br |
| InChI | InChI=1S/C18H12Br2ClN3O4/c1-2-28-17-13(19)6-10(7-14(17)20)5-11(9-22)18(25)23-15-4-3-12(21)8-16(15)24(26)27/h3-8H,2H2,1H3,(H,23,25) |
| InChIKey | HNVUFYREBNSLML-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 105.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.57 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|