C20H15Br2N3O5 — CID 3696175
2-cyano-3-(3,5-dibromo-4-prop-2-enoxyphenyl)-N-(4-methoxy-2-nitrophenyl)prop-2-enamide (PubChem CID 3696175) has the molecular formula C20H15Br2N3O5 and a molecular weight of 537.16 g/mol. Its IUPAC name is 2-cyano-3-(3,5-dibromo-4-prop-2-enoxyphenyl)-N-(4-methoxy-2-nitrophenyl)prop-2-enamide.
| Compound Name | 2-cyano-3-(3,5-dibromo-4-prop-2-enoxyphenyl)-N-(4-methoxy-2-nitrophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 3696175 |
| Molecular Formula | C20H15Br2N3O5 |
| Molecular Weight | 537.16 g/mol |
| Exact Mass | 534.94 |
| IUPAC Name | 2-cyano-3-(3,5-dibromo-4-prop-2-enoxyphenyl)-N-(4-methoxy-2-nitrophenyl)prop-2-enamide |
| SMILES | C=CCOc1c(Br)cc(C=C(C#N)C(=O)Nc2ccc(OC)cc2[N+](=O)[O-])cc1Br |
| InChI | InChI=1S/C20H15Br2N3O5/c1-3-6-30-19-15(21)8-12(9-16(19)22)7-13(11-23)20(26)24-17-5-4-14(29-2)10-18(17)25(27)28/h3-5,7-10H,1,6H2,2H3,(H,24,26) |
| InChIKey | HJPZSDNNXBEXLH-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 114.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.16 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|