C27H15BrClN3O5 — CID 3909741
[2-bromo-4-[3-(4-chloro-2-nitroanilino)-2-cyano-3-oxoprop-1-enyl]phenyl] naphthalene-1-carboxylate (PubChem CID 3909741) has the molecular formula C27H15BrClN3O5 and a molecular weight of 576.79 g/mol. Its IUPAC name is [2-bromo-4-[3-(4-chloro-2-nitroanilino)-2-cyano-3-oxoprop-1-enyl]phenyl] naphthalene-1-carboxylate.
| Compound Name | [2-bromo-4-[3-(4-chloro-2-nitroanilino)-2-cyano-3-oxoprop-1-enyl]phenyl] naphthalene-1-carboxylate |
|---|---|
| PubChem CID | 3909741 |
| Molecular Formula | C27H15BrClN3O5 |
| Molecular Weight | 576.79 g/mol |
| Exact Mass | 574.99 |
| IUPAC Name | [2-bromo-4-[3-(4-chloro-2-nitroanilino)-2-cyano-3-oxoprop-1-enyl]phenyl] naphthalene-1-carboxylate |
| SMILES | N#CC(=Cc1ccc(OC(=O)c2cccc3ccccc23)c(Br)c1)C(=O)Nc1ccc(Cl)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C27H15BrClN3O5/c28-22-13-16(12-18(15-30)26(33)31-23-10-9-19(29)14-24(23)32(35)36)8-11-25(22)37-27(34)21-7-3-5-17-4-1-2-6-20(17)21/h1-14H,(H,31,33) |
| InChIKey | SKHDSXHBVUQMAX-UHFFFAOYSA-N |
| XLogP | 6.93 |
| TPSA | 122.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.79 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|