C27H18BrN3O4 — CID 6079180
(E)-3-[3-bromo-4-(naphthalen-1-ylmethoxy)phenyl]-2-cyano-N-(2-nitrophenyl)prop-2-enamide (PubChem CID 6079180) has the molecular formula C27H18BrN3O4 and a molecular weight of 528.36 g/mol. Its IUPAC name is (E)-3-[3-bromo-4-(naphthalen-1-ylmethoxy)phenyl]-2-cyano-N-(2-nitrophenyl)prop-2-enamide.
| Compound Name | (E)-3-[3-bromo-4-(naphthalen-1-ylmethoxy)phenyl]-2-cyano-N-(2-nitrophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 6079180 |
| Molecular Formula | C27H18BrN3O4 |
| Molecular Weight | 528.36 g/mol |
| Exact Mass | 527.05 |
| IUPAC Name | (E)-3-[3-bromo-4-(naphthalen-1-ylmethoxy)phenyl]-2-cyano-N-(2-nitrophenyl)prop-2-enamide |
| SMILES | N#C/C(=C\c1ccc(OCc2cccc3ccccc23)c(Br)c1)C(=O)Nc1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C27H18BrN3O4/c28-23-15-18(14-21(16-29)27(32)30-24-10-3-4-11-25(24)31(33)34)12-13-26(23)35-17-20-8-5-7-19-6-1-2-9-22(19)20/h1-15H,17H2,(H,30,32)/b21-14+ |
| InChIKey | OGZZHNCJUCMROM-KGENOOAVSA-N |
| XLogP | 6.64 |
| TPSA | 105.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.36 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|