C18H11ClN4O3 — CID 20834810
(Z)-N-(4-chloro-2-nitrophenyl)-2-cyano-3-(1H-indol-3-yl)prop-2-enamide (PubChem CID 20834810) has the molecular formula C18H11ClN4O3 and a molecular weight of 366.76 g/mol. Its IUPAC name is (Z)-N-(4-chloro-2-nitrophenyl)-2-cyano-3-(1H-indol-3-yl)prop-2-enamide.
| Compound Name | (Z)-N-(4-chloro-2-nitrophenyl)-2-cyano-3-(1H-indol-3-yl)prop-2-enamide |
|---|---|
| PubChem CID | 20834810 |
| Molecular Formula | C18H11ClN4O3 |
| Molecular Weight | 366.76 g/mol |
| Exact Mass | 366.05 |
| IUPAC Name | (Z)-N-(4-chloro-2-nitrophenyl)-2-cyano-3-(1H-indol-3-yl)prop-2-enamide |
| SMILES | N#C/C(=C/c1c[nH]c2ccccc12)C(=O)Nc1ccc(Cl)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C18H11ClN4O3/c19-13-5-6-16(17(8-13)23(25)26)22-18(24)11(9-20)7-12-10-21-15-4-2-1-3-14(12)15/h1-8,10,21H,(H,22,24)/b11-7- |
| InChIKey | VTVVREYUBFPLAJ-XFFZJAGNSA-N |
| XLogP | 4.28 |
| TPSA | 111.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.76 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|