C18H12N4O3 — CID 916319
(E)-2-cyano-3-(1H-indol-3-yl)-N-(3-nitrophenyl)prop-2-enamide (PubChem CID 916319) has the molecular formula C18H12N4O3 and a molecular weight of 332.32 g/mol. Its IUPAC name is (E)-2-cyano-3-(1H-indol-3-yl)-N-(3-nitrophenyl)prop-2-enamide.
| Compound Name | (E)-2-cyano-3-(1H-indol-3-yl)-N-(3-nitrophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 916319 |
| Molecular Formula | C18H12N4O3 |
| Molecular Weight | 332.32 g/mol |
| Exact Mass | 332.09 |
| IUPAC Name | (E)-2-cyano-3-(1H-indol-3-yl)-N-(3-nitrophenyl)prop-2-enamide |
| SMILES | N#C/C(=C\c1c[nH]c2ccccc12)C(=O)Nc1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C18H12N4O3/c19-10-12(8-13-11-20-17-7-2-1-6-16(13)17)18(23)21-14-4-3-5-15(9-14)22(24)25/h1-9,11,20H,(H,21,23)/b12-8+ |
| InChIKey | YXMCPYDMUBCSPG-XYOKQWHBSA-N |
| XLogP | 3.62 |
| TPSA | 111.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.32 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|