C19H12ClN5O3 — CID 17380878
(E)-3-[5-(4-chlorophenyl)-1H-pyrazol-4-yl]-2-cyano-N-(2-nitrophenyl)prop-2-enamide (PubChem CID 17380878) has the molecular formula C19H12ClN5O3 and a molecular weight of 393.79 g/mol. Its IUPAC name is (E)-3-[5-(4-chlorophenyl)-1H-pyrazol-4-yl]-2-cyano-N-(2-nitrophenyl)prop-2-enamide.
| Compound Name | (E)-3-[5-(4-chlorophenyl)-1H-pyrazol-4-yl]-2-cyano-N-(2-nitrophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 17380878 |
| Molecular Formula | C19H12ClN5O3 |
| Molecular Weight | 393.79 g/mol |
| Exact Mass | 393.06 |
| IUPAC Name | (E)-3-[5-(4-chlorophenyl)-1H-pyrazol-4-yl]-2-cyano-N-(2-nitrophenyl)prop-2-enamide |
| SMILES | N#C/C(=C\c1cn[nH]c1-c1ccc(Cl)cc1)C(=O)Nc1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C19H12ClN5O3/c20-15-7-5-12(6-8-15)18-14(11-22-24-18)9-13(10-21)19(26)23-16-3-1-2-4-17(16)25(27)28/h1-9,11H,(H,22,24)(H,23,26)/b13-9+ |
| InChIKey | OPUXUKUEGWAYNO-UKTHLTGXSA-N |
| XLogP | 4.18 |
| TPSA | 124.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.79 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|