C20H14BrClN4O2 — CID 4284285
3-[5-(4-bromophenyl)-1H-pyrazol-4-yl]-N-(5-chloro-2-methoxyphenyl)-2-cyanoprop-2-enamide (PubChem CID 4284285) has the molecular formula C20H14BrClN4O2 and a molecular weight of 457.72 g/mol. Its IUPAC name is 3-[5-(4-bromophenyl)-1H-pyrazol-4-yl]-N-(5-chloro-2-methoxyphenyl)-2-cyanoprop-2-enamide.
| Compound Name | 3-[5-(4-bromophenyl)-1H-pyrazol-4-yl]-N-(5-chloro-2-methoxyphenyl)-2-cyanoprop-2-enamide |
|---|---|
| PubChem CID | 4284285 |
| Molecular Formula | C20H14BrClN4O2 |
| Molecular Weight | 457.72 g/mol |
| Exact Mass | 456.00 |
| IUPAC Name | 3-[5-(4-bromophenyl)-1H-pyrazol-4-yl]-N-(5-chloro-2-methoxyphenyl)-2-cyanoprop-2-enamide |
| SMILES | COc1ccc(Cl)cc1NC(=O)C(C#N)=Cc1cn[nH]c1-c1ccc(Br)cc1 |
| InChI | InChI=1S/C20H14BrClN4O2/c1-28-18-7-6-16(22)9-17(18)25-20(27)13(10-23)8-14-11-24-26-19(14)12-2-4-15(21)5-3-12/h2-9,11H,1H3,(H,24,26)(H,25,27) |
| InChIKey | IQNRUXSIEJTQPG-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 90.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.72 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|