C20H14ClN5O3 — CID 51570841
N-(2-chloro-5-nitrophenyl)-2-cyano-3-[5-(4-methylphenyl)-1H-pyrazol-4-yl]prop-2-enamide (PubChem CID 51570841) has the molecular formula C20H14ClN5O3 and a molecular weight of 407.82 g/mol. Its IUPAC name is N-(2-chloro-5-nitrophenyl)-2-cyano-3-[5-(4-methylphenyl)-1H-pyrazol-4-yl]prop-2-enamide.
| Compound Name | N-(2-chloro-5-nitrophenyl)-2-cyano-3-[5-(4-methylphenyl)-1H-pyrazol-4-yl]prop-2-enamide |
|---|---|
| PubChem CID | 51570841 |
| Molecular Formula | C20H14ClN5O3 |
| Molecular Weight | 407.82 g/mol |
| Exact Mass | 407.08 |
| IUPAC Name | N-(2-chloro-5-nitrophenyl)-2-cyano-3-[5-(4-methylphenyl)-1H-pyrazol-4-yl]prop-2-enamide |
| SMILES | Cc1ccc(-c2[nH]ncc2C=C(C#N)C(=O)Nc2cc([N+](=O)[O-])ccc2Cl)cc1 |
| InChI | InChI=1S/C20H14ClN5O3/c1-12-2-4-13(5-3-12)19-15(11-23-25-19)8-14(10-22)20(27)24-18-9-16(26(28)29)6-7-17(18)21/h2-9,11H,1H3,(H,23,25)(H,24,27) |
| InChIKey | PYPCASYFJLAUFO-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 124.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.82 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|