C12H8ClN7O3 — CID 108853845
(Z)-N-(2-chloro-5-nitrophenyl)-2-cyano-3-(1H-1,2,4-triazol-5-ylamino)prop-2-enamide (PubChem CID 108853845) has the molecular formula C12H8ClN7O3 and a molecular weight of 333.70 g/mol. Its IUPAC name is (Z)-N-(2-chloro-5-nitrophenyl)-2-cyano-3-(1H-1,2,4-triazol-5-ylamino)prop-2-enamide.
| Compound Name | (Z)-N-(2-chloro-5-nitrophenyl)-2-cyano-3-(1H-1,2,4-triazol-5-ylamino)prop-2-enamide |
|---|---|
| PubChem CID | 108853845 |
| Molecular Formula | C12H8ClN7O3 |
| Molecular Weight | 333.70 g/mol |
| Exact Mass | 333.04 |
| IUPAC Name | (Z)-N-(2-chloro-5-nitrophenyl)-2-cyano-3-(1H-1,2,4-triazol-5-ylamino)prop-2-enamide |
| SMILES | N#C/C(=C/Nc1ncn[nH]1)C(=O)Nc1cc([N+](=O)[O-])ccc1Cl |
| InChI | InChI=1S/C12H8ClN7O3/c13-9-2-1-8(20(22)23)3-10(9)18-11(21)7(4-14)5-15-12-16-6-17-19-12/h1-3,5-6H,(H,18,21)(H2,15,16,17,19)/b7-5- |
| InChIKey | VEZVDHAXXSSVFP-ALCCZGGFSA-N |
| XLogP | 1.82 |
| TPSA | 149.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.70 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|