C13H11ClN6O — CID 108850125
(Z)-N-(5-chloro-2-methylphenyl)-2-cyano-3-(1H-1,2,4-triazol-5-ylamino)prop-2-enamide (PubChem CID 108850125) has the molecular formula C13H11ClN6O and a molecular weight of 302.73 g/mol. Its IUPAC name is (Z)-N-(5-chloro-2-methylphenyl)-2-cyano-3-(1H-1,2,4-triazol-5-ylamino)prop-2-enamide.
| Compound Name | (Z)-N-(5-chloro-2-methylphenyl)-2-cyano-3-(1H-1,2,4-triazol-5-ylamino)prop-2-enamide |
|---|---|
| PubChem CID | 108850125 |
| Molecular Formula | C13H11ClN6O |
| Molecular Weight | 302.73 g/mol |
| Exact Mass | 302.07 |
| IUPAC Name | (Z)-N-(5-chloro-2-methylphenyl)-2-cyano-3-(1H-1,2,4-triazol-5-ylamino)prop-2-enamide |
| SMILES | Cc1ccc(Cl)cc1NC(=O)/C(C#N)=C\Nc1ncn[nH]1 |
| InChI | InChI=1S/C13H11ClN6O/c1-8-2-3-10(14)4-11(8)19-12(21)9(5-15)6-16-13-17-7-18-20-13/h2-4,6-7H,1H3,(H,19,21)(H2,16,17,18,20)/b9-6- |
| InChIKey | WQERIOQBHISMLU-TWGQIWQCSA-N |
| XLogP | 2.22 |
| TPSA | 106.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.73 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|