C13H9F3N6O — CID 108822998
(Z)-2-cyano-3-(1H-1,2,4-triazol-5-ylamino)-N-[2-(trifluoromethyl)phenyl]prop-2-enamide (PubChem CID 108822998) has the molecular formula C13H9F3N6O and a molecular weight of 322.25 g/mol. Its IUPAC name is (Z)-2-cyano-3-(1H-1,2,4-triazol-5-ylamino)-N-[2-(trifluoromethyl)phenyl]prop-2-enamide.
| Compound Name | (Z)-2-cyano-3-(1H-1,2,4-triazol-5-ylamino)-N-[2-(trifluoromethyl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 108822998 |
| Molecular Formula | C13H9F3N6O |
| Molecular Weight | 322.25 g/mol |
| Exact Mass | 322.08 |
| IUPAC Name | (Z)-2-cyano-3-(1H-1,2,4-triazol-5-ylamino)-N-[2-(trifluoromethyl)phenyl]prop-2-enamide |
| SMILES | N#C/C(=C/Nc1ncn[nH]1)C(=O)Nc1ccccc1C(F)(F)F |
| InChI | InChI=1S/C13H9F3N6O/c14-13(15,16)9-3-1-2-4-10(9)21-11(23)8(5-17)6-18-12-19-7-20-22-12/h1-4,6-7H,(H,21,23)(H2,18,19,20,22)/b8-6- |
| InChIKey | PJGOKRWLSXBXIK-VURMDHGXSA-N |
| XLogP | 2.28 |
| TPSA | 106.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.25 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|