C12H9FN6O — CID 108851985
(Z)-2-cyano-N-(4-fluorophenyl)-3-(1H-1,2,4-triazol-5-ylamino)prop-2-enamide (PubChem CID 108851985) has the molecular formula C12H9FN6O and a molecular weight of 272.24 g/mol. Its IUPAC name is (Z)-2-cyano-N-(4-fluorophenyl)-3-(1H-1,2,4-triazol-5-ylamino)prop-2-enamide.
| Compound Name | (Z)-2-cyano-N-(4-fluorophenyl)-3-(1H-1,2,4-triazol-5-ylamino)prop-2-enamide |
|---|---|
| PubChem CID | 108851985 |
| Molecular Formula | C12H9FN6O |
| Molecular Weight | 272.24 g/mol |
| Exact Mass | 272.08 |
| IUPAC Name | (Z)-2-cyano-N-(4-fluorophenyl)-3-(1H-1,2,4-triazol-5-ylamino)prop-2-enamide |
| SMILES | N#C/C(=C/Nc1ncn[nH]1)C(=O)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C12H9FN6O/c13-9-1-3-10(4-2-9)18-11(20)8(5-14)6-15-12-16-7-17-19-12/h1-4,6-7H,(H,18,20)(H2,15,16,17,19)/b8-6- |
| InChIKey | HLYHMDKBKKSXGY-VURMDHGXSA-N |
| XLogP | 1.40 |
| TPSA | 106.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.24 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|