C14H14N6O3 — CID 108815180
(Z)-2-cyano-N-(3,4-dimethoxyphenyl)-3-(1H-1,2,4-triazol-5-ylamino)prop-2-enamide (PubChem CID 108815180) has the molecular formula C14H14N6O3 and a molecular weight of 314.31 g/mol. Its IUPAC name is (Z)-2-cyano-N-(3,4-dimethoxyphenyl)-3-(1H-1,2,4-triazol-5-ylamino)prop-2-enamide.
| Compound Name | (Z)-2-cyano-N-(3,4-dimethoxyphenyl)-3-(1H-1,2,4-triazol-5-ylamino)prop-2-enamide |
|---|---|
| PubChem CID | 108815180 |
| Molecular Formula | C14H14N6O3 |
| Molecular Weight | 314.31 g/mol |
| Exact Mass | 314.11 |
| IUPAC Name | (Z)-2-cyano-N-(3,4-dimethoxyphenyl)-3-(1H-1,2,4-triazol-5-ylamino)prop-2-enamide |
| SMILES | COc1ccc(NC(=O)/C(C#N)=C\Nc2ncn[nH]2)cc1OC |
| InChI | InChI=1S/C14H14N6O3/c1-22-11-4-3-10(5-12(11)23-2)19-13(21)9(6-15)7-16-14-17-8-18-20-14/h3-5,7-8H,1-2H3,(H,19,21)(H2,16,17,18,20)/b9-7- |
| InChIKey | UPBYGBPCMIVNQZ-CLFYSBASSA-N |
| XLogP | 1.28 |
| TPSA | 124.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.31 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|