C19H17N3O5 — CID 108823132
4-[[(Z)-2-cyano-3-(3,4-dimethoxyanilino)prop-2-enoyl]amino]benzoic acid (PubChem CID 108823132) has the molecular formula C19H17N3O5 and a molecular weight of 367.36 g/mol. Its IUPAC name is 4-[[(Z)-2-cyano-3-(3,4-dimethoxyanilino)prop-2-enoyl]amino]benzoic acid.
| Compound Name | 4-[[(Z)-2-cyano-3-(3,4-dimethoxyanilino)prop-2-enoyl]amino]benzoic acid |
|---|---|
| PubChem CID | 108823132 |
| Molecular Formula | C19H17N3O5 |
| Molecular Weight | 367.36 g/mol |
| Exact Mass | 367.12 |
| IUPAC Name | 4-[[(Z)-2-cyano-3-(3,4-dimethoxyanilino)prop-2-enoyl]amino]benzoic acid |
| SMILES | COc1ccc(N/C=C(/C#N)C(=O)Nc2ccc(C(=O)O)cc2)cc1OC |
| InChI | InChI=1S/C19H17N3O5/c1-26-16-8-7-15(9-17(16)27-2)21-11-13(10-20)18(23)22-14-5-3-12(4-6-14)19(24)25/h3-9,11,21H,1-2H3,(H,22,23)(H,24,25)/b13-11- |
| InChIKey | SWOZWKKQRMSCMC-QBFSEMIESA-N |
| XLogP | 2.86 |
| TPSA | 120.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.36 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|